About 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene
1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene (PubChem CID 174491340) has the molecular formula C28H32O
and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene |
| PubChem CID | 174491340 |
| Molecular Formula | C28H32O |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene |
| SMILES | C=Cc1ccc(C(C)(C)C)cc1.C=Cc1ccc(O)cc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C12H16.C8H8O.C8H8/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-2-7-3-5-8(9)6-4-7;1-2-8-6-4-3-5-7-8/h5-9H,1H2,2-4H3;2-6,9H,1H2;2-7H,1H2 |
| InChIKey | JGDOKACKQSQWMH-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene?
The IUPAC name of 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene (CID 174491340) is 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene.
What is the SMILES notation for 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene?
The canonical SMILES for 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene is C=Cc1ccc(C(C)(C)C)cc1.C=Cc1ccc(O)cc1.C=Cc1ccccc1.
What is the InChIKey of 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene?
The InChIKey is JGDOKACKQSQWMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C8H8O.C8H8/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-2-7-3-5-8(9)6-4-7;1-2-8-6-4-3-5-7-8/h5-9H,1H2,2-4H3;2-6,9H,1H2;2-7H,1H2.
What are the key properties of 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene?
1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene has a molecular weight of 384.56 g/mol, XLogP of 7.99, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-ethenylbenzene;4-ethenylphenol;styrene is sourced from PubChem (CID 174491340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).