C23H24O4 — CID 158748751
2-methylidene-5-phenylpent-4-enoic acid;prop-2-enoic acid;styrene (PubChem CID 158748751) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-methylidene-5-phenylpent-4-enoic acid;prop-2-enoic acid;styrene.
| Compound Name | 2-methylidene-5-phenylpent-4-enoic acid;prop-2-enoic acid;styrene |
|---|---|
| PubChem CID | 158748751 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-methylidene-5-phenylpent-4-enoic acid;prop-2-enoic acid;styrene |
| SMILES | C=C(CC=Cc1ccccc1)C(=O)O.C=CC(=O)O.C=Cc1ccccc1 |
| InChI | InChI=1S/C12H12O2.C8H8.C3H4O2/c1-10(12(13)14)6-5-9-11-7-3-2-4-8-11;1-2-8-6-4-3-5-7-8;1-2-3(4)5/h2-5,7-9H,1,6H2,(H,13,14);2-7H,1H2;2H,1H2,(H,4,5) |
| InChIKey | INEVZSNHEAUIFJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|