C17H20O4 — CID 70152927
2-methylbut-2-enoic acid;2-methylidene-5-phenylpent-4-enoic acid (PubChem CID 70152927) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-methylbut-2-enoic acid;2-methylidene-5-phenylpent-4-enoic acid.
| Compound Name | 2-methylbut-2-enoic acid;2-methylidene-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 70152927 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-methylbut-2-enoic acid;2-methylidene-5-phenylpent-4-enoic acid |
| SMILES | C=C(CC=Cc1ccccc1)C(=O)O.CC=C(C)C(=O)O |
| InChI | InChI=1S/C12H12O2.C5H8O2/c1-10(12(13)14)6-5-9-11-7-3-2-4-8-11;1-3-4(2)5(6)7/h2-5,7-9H,1,6H2,(H,13,14);3H,1-2H3,(H,6,7) |
| InChIKey | YQUIEFQKCAFIRW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|