C22H24O — CID 161166540
1,2-bis(ethenyl)benzene;2-methylprop-2-enal;styrene (PubChem CID 161166540) has the molecular formula C22H24O and a molecular weight of 304.43 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;2-methylprop-2-enal;styrene.
| Compound Name | 1,2-bis(ethenyl)benzene;2-methylprop-2-enal;styrene |
|---|---|
| PubChem CID | 161166540 |
| Molecular Formula | C22H24O |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-methylprop-2-enal;styrene |
| SMILES | C=C(C)C=O.C=Cc1ccccc1.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H10.C8H8.C4H6O/c1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8;1-4(2)3-5/h3-8H,1-2H2;2-7H,1H2;3H,1H2,2H3 |
| InChIKey | UQPOSUYJVBOWSB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|