C16H24O2 — CID 23504193
1-ethenyl-4-(2-ethoxy-3,3-dimethylbutan-2-yl)oxybenzene (PubChem CID 23504193) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-ethenyl-4-(2-ethoxy-3,3-dimethylbutan-2-yl)oxybenzene.
| Compound Name | 1-ethenyl-4-(2-ethoxy-3,3-dimethylbutan-2-yl)oxybenzene |
|---|---|
| PubChem CID | 23504193 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-ethenyl-4-(2-ethoxy-3,3-dimethylbutan-2-yl)oxybenzene |
| SMILES | C=Cc1ccc(OC(C)(OCC)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24O2/c1-7-13-9-11-14(12-10-13)18-16(6,17-8-2)15(3,4)5/h7,9-12H,1,8H2,2-6H3 |
| InChIKey | UIMVCGIQNUMBIX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|