C19H30O2 — CID 23504259
1-ethenyl-4-(2-hexoxy-3-methylbutan-2-yl)oxybenzene (PubChem CID 23504259) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-ethenyl-4-(2-hexoxy-3-methylbutan-2-yl)oxybenzene.
| Compound Name | 1-ethenyl-4-(2-hexoxy-3-methylbutan-2-yl)oxybenzene |
|---|---|
| PubChem CID | 23504259 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-ethenyl-4-(2-hexoxy-3-methylbutan-2-yl)oxybenzene |
| SMILES | C=Cc1ccc(OC(C)(OCCCCCC)C(C)C)cc1 |
| InChI | InChI=1S/C19H30O2/c1-6-8-9-10-15-20-19(5,16(3)4)21-18-13-11-17(7-2)12-14-18/h7,11-14,16H,2,6,8-10,15H2,1,3-5H3 |
| InChIKey | IWJKKYQLEVFDEE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|