About 1-ethenoxypentane;1-ethenyl-4-ethylbenzene
1-ethenoxypentane;1-ethenyl-4-ethylbenzene (PubChem CID 54369446) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-ethenoxypentane;1-ethenyl-4-ethylbenzene.
Molecular Properties
| Compound Name | 1-ethenoxypentane;1-ethenyl-4-ethylbenzene |
| PubChem CID | 54369446 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-ethenoxypentane;1-ethenyl-4-ethylbenzene |
| SMILES | C=COCCCCC.C=Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C10H12.C7H14O/c1-3-9-5-7-10(4-2)8-6-9;1-3-5-6-7-8-4-2/h3,5-8H,1,4H2,2H3;4H,2-3,5-7H2,1H3 |
| InChIKey | USCPNCBYBIZBIB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxypentane;1-ethenyl-4-ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxypentane;1-ethenyl-4-ethylbenzene?
The IUPAC name of 1-ethenoxypentane;1-ethenyl-4-ethylbenzene (CID 54369446) is 1-ethenoxypentane;1-ethenyl-4-ethylbenzene.
What is the SMILES notation for 1-ethenoxypentane;1-ethenyl-4-ethylbenzene?
The canonical SMILES for 1-ethenoxypentane;1-ethenyl-4-ethylbenzene is C=COCCCCC.C=Cc1ccc(CC)cc1.
What is the InChIKey of 1-ethenoxypentane;1-ethenyl-4-ethylbenzene?
The InChIKey is USCPNCBYBIZBIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C7H14O/c1-3-9-5-7-10(4-2)8-6-9;1-3-5-6-7-8-4-2/h3,5-8H,1,4H2,2H3;4H,2-3,5-7H2,1H3.
What are the key properties of 1-ethenoxypentane;1-ethenyl-4-ethylbenzene?
1-ethenoxypentane;1-ethenyl-4-ethylbenzene has a molecular weight of 246.39 g/mol, XLogP of 5.23, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxypentane;1-ethenyl-4-ethylbenzene is sourced from PubChem (CID 54369446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).