C20H30O2 — CID 23504210
1-(2-cyclohexyloxy-3,3-dimethylbutan-2-yl)oxy-4-ethenylbenzene (PubChem CID 23504210) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-(2-cyclohexyloxy-3,3-dimethylbutan-2-yl)oxy-4-ethenylbenzene.
| Compound Name | 1-(2-cyclohexyloxy-3,3-dimethylbutan-2-yl)oxy-4-ethenylbenzene |
|---|---|
| PubChem CID | 23504210 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-(2-cyclohexyloxy-3,3-dimethylbutan-2-yl)oxy-4-ethenylbenzene |
| SMILES | C=Cc1ccc(OC(C)(OC2CCCCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H30O2/c1-6-16-12-14-18(15-13-16)22-20(5,19(2,3)4)21-17-10-8-7-9-11-17/h6,12-15,17H,1,7-11H2,2-5H3 |
| InChIKey | RKRVIIRMWAWTRO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|