About 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene
1-chloro-2-ethenylbenzene;2-chloroethenylbenzene (PubChem CID 161200369) has the molecular formula C16H14Cl2
and a molecular weight of 277.19 g/mol. Its IUPAC name is 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene |
| PubChem CID | 161200369 |
| Molecular Formula | C16H14Cl2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene |
| SMILES | C=Cc1ccccc1Cl.ClC=Cc1ccccc1 |
| InChI | InChI=1S/2C8H7Cl/c1-2-7-5-3-4-6-8(7)9;9-7-6-8-4-2-1-3-5-8/h2-6H,1H2;1-7H |
| InChIKey | UUWXNBNCDNFVAD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene?
The IUPAC name of 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene (CID 161200369) is 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene.
What is the SMILES notation for 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene?
The canonical SMILES for 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene is C=Cc1ccccc1Cl.ClC=Cc1ccccc1.
What is the InChIKey of 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene?
The InChIKey is UUWXNBNCDNFVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7Cl/c1-2-7-5-3-4-6-8(7)9;9-7-6-8-4-2-1-3-5-8/h2-6H,1H2;1-7H.
What are the key properties of 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene?
1-chloro-2-ethenylbenzene;2-chloroethenylbenzene has a molecular weight of 277.19 g/mol, XLogP of 5.88, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-ethenylbenzene;2-chloroethenylbenzene is sourced from PubChem (CID 161200369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).