C20H14O4 — CID 174341530
4-(4,5-dioxopyren-1-yl)butanoic acid (PubChem CID 174341530) has the molecular formula C20H14O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-(4,5-dioxopyren-1-yl)butanoic acid.
| Compound Name | 4-(4,5-dioxopyren-1-yl)butanoic acid |
|---|---|
| PubChem CID | 174341530 |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-(4,5-dioxopyren-1-yl)butanoic acid |
| SMILES | O=C(O)CCCc1ccc2c(=O)c(=O)c3cccc4ccc1c2c43 |
| InChI | InChI=1S/C20H14O4/c21-16(22)6-2-3-11-7-10-15-18-13(11)9-8-12-4-1-5-14(17(12)18)19(23)20(15)24/h1,4-5,7-10H,2-3,6H2,(H,21,22) |
| InChIKey | QVFWLKXKHYFBAG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|