About 4-pyren-2-ylbutanoic acid
4-pyren-2-ylbutanoic acid (PubChem CID 13113907) has the molecular formula C20H16O2
and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-pyren-2-ylbutanoic acid.
Molecular Properties
| Compound Name | 4-pyren-2-ylbutanoic acid |
| PubChem CID | 13113907 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-pyren-2-ylbutanoic acid |
| SMILES | O=C(O)CCCc1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C20H16O2/c21-18(22)6-1-3-13-11-16-9-7-14-4-2-5-15-8-10-17(12-13)20(16)19(14)15/h2,4-5,7-12H,1,3,6H2,(H,21,22) |
| InChIKey | BCDIYAIONAIKLH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-pyren-2-ylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyren-2-ylbutanoic acid?
The IUPAC name of 4-pyren-2-ylbutanoic acid (CID 13113907) is 4-pyren-2-ylbutanoic acid.
What is the SMILES notation for 4-pyren-2-ylbutanoic acid?
The canonical SMILES for 4-pyren-2-ylbutanoic acid is O=C(O)CCCc1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of 4-pyren-2-ylbutanoic acid?
The InChIKey is BCDIYAIONAIKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O2/c21-18(22)6-1-3-13-11-16-9-7-14-4-2-5-15-8-10-17(12-13)20(16)19(14)15/h2,4-5,7-12H,1,3,6H2,(H,21,22).
What are the key properties of 4-pyren-2-ylbutanoic acid?
4-pyren-2-ylbutanoic acid has a molecular weight of 288.35 g/mol, XLogP of 4.99, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyren-2-ylbutanoic acid is sourced from PubChem (CID 13113907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).