C10H14N2O2 — CID 151286992
4-(3,5-diaminophenyl)butanoic acid (PubChem CID 151286992) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(3,5-diaminophenyl)butanoic acid.
| Compound Name | 4-(3,5-diaminophenyl)butanoic acid |
|---|---|
| PubChem CID | 151286992 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-(3,5-diaminophenyl)butanoic acid |
| SMILES | Nc1cc(N)cc(CCCC(=O)O)c1 |
| InChI | InChI=1S/C10H14N2O2/c11-8-4-7(5-9(12)6-8)2-1-3-10(13)14/h4-6H,1-3,11-12H2,(H,13,14) |
| InChIKey | NZPLUXSDBHXQJP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|