C10H14ClNO2 — CID 11715486
4-(3-aminophenyl)butanoic acid;hydrochloride (PubChem CID 11715486) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 4-(3-aminophenyl)butanoic acid;hydrochloride.
| Compound Name | 4-(3-aminophenyl)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 11715486 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 4-(3-aminophenyl)butanoic acid;hydrochloride |
| SMILES | Cl.Nc1cccc(CCCC(=O)O)c1 |
| InChI | InChI=1S/C10H13NO2.ClH/c11-9-5-1-3-8(7-9)4-2-6-10(12)13;/h1,3,5,7H,2,4,6,11H2,(H,12,13);1H |
| InChIKey | KQDRRBHCFUEQIW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|