C26H20O8 — CID 131727342
4-anthracen-2-ylbutanoic acid;4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 131727342) has the molecular formula C26H20O8 and a molecular weight of 460.44 g/mol. Its IUPAC name is 4-anthracen-2-ylbutanoic acid;4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 4-anthracen-2-ylbutanoic acid;4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 131727342 |
| Molecular Formula | C26H20O8 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-anthracen-2-ylbutanoic acid;4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | O=C(O)CCCc1ccc2cc3ccccc3cc2c1.O=C1OC(=O)C2C1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C18H16O2.C8H4O6/c19-18(20)7-3-4-13-8-9-16-11-14-5-1-2-6-15(14)12-17(16)10-13;9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h1-2,5-6,8-12H,3-4,7H2,(H,19,20);1-4H |
| InChIKey | VDRRCDSTELAQQR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|