C23H22O4 — CID 88671643
1,2-dihydroxy-2-(hydroxymethyl)-6-pyren-1-ylhexan-3-one (PubChem CID 88671643) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1,2-dihydroxy-2-(hydroxymethyl)-6-pyren-1-ylhexan-3-one.
| Compound Name | 1,2-dihydroxy-2-(hydroxymethyl)-6-pyren-1-ylhexan-3-one |
|---|---|
| PubChem CID | 88671643 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1,2-dihydroxy-2-(hydroxymethyl)-6-pyren-1-ylhexan-3-one |
| SMILES | O=C(CCCc1ccc2ccc3cccc4ccc1c2c34)C(O)(CO)CO |
| InChI | InChI=1S/C23H22O4/c24-13-23(27,14-25)20(26)6-2-3-15-7-8-18-10-9-16-4-1-5-17-11-12-19(15)22(18)21(16)17/h1,4-5,7-12,24-25,27H,2-3,6,13-14H2 |
| InChIKey | BCVVLRRBNVFCLQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|