C15H16ClNO3 — CID 122377688
N-butyl-3-chloro-1,4-dihydroxynaphthalene-2-carboxamide (PubChem CID 122377688) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is N-butyl-3-chloro-1,4-dihydroxynaphthalene-2-carboxamide.
| Compound Name | N-butyl-3-chloro-1,4-dihydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 122377688 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-butyl-3-chloro-1,4-dihydroxynaphthalene-2-carboxamide |
| SMILES | CCCCNC(=O)c1c(Cl)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C15H16ClNO3/c1-2-3-8-17-15(20)11-12(16)14(19)10-7-5-4-6-9(10)13(11)18/h4-7,18-19H,2-3,8H2,1H3,(H,17,20) |
| InChIKey | CLAKSTXMKOCSKK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|