C12H15Cl2NO4 — CID 46892802
N-butyl-3,5-dichloro-2,6-dihydroxy-4-methoxybenzamide (PubChem CID 46892802) has the molecular formula C12H15Cl2NO4 and a molecular weight of 308.16 g/mol. Its IUPAC name is N-butyl-3,5-dichloro-2,6-dihydroxy-4-methoxybenzamide.
| Compound Name | N-butyl-3,5-dichloro-2,6-dihydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 46892802 |
| Molecular Formula | C12H15Cl2NO4 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-butyl-3,5-dichloro-2,6-dihydroxy-4-methoxybenzamide |
| SMILES | CCCCNC(=O)c1c(O)c(Cl)c(OC)c(Cl)c1O |
| InChI | InChI=1S/C12H15Cl2NO4/c1-3-4-5-15-12(18)6-9(16)7(13)11(19-2)8(14)10(6)17/h16-17H,3-5H2,1-2H3,(H,15,18) |
| InChIKey | XEJQPZKFYUAXPA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|