C15H20Cl2O4 — CID 42600341
1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)octan-1-one (PubChem CID 42600341) has the molecular formula C15H20Cl2O4 and a molecular weight of 335.23 g/mol. Its IUPAC name is 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)octan-1-one.
| Compound Name | 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)octan-1-one |
|---|---|
| PubChem CID | 42600341 |
| Molecular Formula | C15H20Cl2O4 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)octan-1-one |
| SMILES | CCCCCCCC(=O)c1c(O)c(Cl)c(OC)c(Cl)c1O |
| InChI | InChI=1S/C15H20Cl2O4/c1-3-4-5-6-7-8-9(18)10-13(19)11(16)15(21-2)12(17)14(10)20/h19-20H,3-8H2,1-2H3 |
| InChIKey | FQSJIDRYXDGPNX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|