C8H8Cl2S2 — CID 129229080
1,4-dichloro-2,3-bis(methylsulfanyl)benzene (PubChem CID 129229080) has the molecular formula C8H8Cl2S2 and a molecular weight of 239.19 g/mol. Its IUPAC name is 1,4-dichloro-2,3-bis(methylsulfanyl)benzene.
| Compound Name | 1,4-dichloro-2,3-bis(methylsulfanyl)benzene |
|---|---|
| PubChem CID | 129229080 |
| Molecular Formula | C8H8Cl2S2 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 237.94 |
| IUPAC Name | 1,4-dichloro-2,3-bis(methylsulfanyl)benzene |
| SMILES | CSc1c(Cl)ccc(Cl)c1SC |
| InChI | InChI=1S/C8H8Cl2S2/c1-11-7-5(9)3-4-6(10)8(7)12-2/h3-4H,1-2H3 |
| InChIKey | IYDDXVOWIOVWLJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |