C8H8ClFS2 — CID 171366507
1-chloro-3-fluoro-2,4-bis(methylsulfanyl)benzene (PubChem CID 171366507) has the molecular formula C8H8ClFS2 and a molecular weight of 222.74 g/mol. Its IUPAC name is 1-chloro-3-fluoro-2,4-bis(methylsulfanyl)benzene.
| Compound Name | 1-chloro-3-fluoro-2,4-bis(methylsulfanyl)benzene |
|---|---|
| PubChem CID | 171366507 |
| Molecular Formula | C8H8ClFS2 |
| Molecular Weight | 222.74 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | 1-chloro-3-fluoro-2,4-bis(methylsulfanyl)benzene |
| SMILES | CSc1ccc(Cl)c(SC)c1F |
| InChI | InChI=1S/C8H8ClFS2/c1-11-6-4-3-5(9)8(12-2)7(6)10/h3-4H,1-2H3 |
| InChIKey | NXZXJLWDXLSAMD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.74 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |