C5H4I2S2 — CID 102403803
2,5-diiodo-3-methylsulfanylthiophene (PubChem CID 102403803) has the molecular formula C5H4I2S2 and a molecular weight of 382.03 g/mol. Its IUPAC name is 2,5-diiodo-3-methylsulfanylthiophene.
| Compound Name | 2,5-diiodo-3-methylsulfanylthiophene |
|---|---|
| PubChem CID | 102403803 |
| Molecular Formula | C5H4I2S2 |
| Molecular Weight | 382.03 g/mol |
| Exact Mass | 381.78 |
| IUPAC Name | 2,5-diiodo-3-methylsulfanylthiophene |
| SMILES | CSc1cc(I)sc1I |
| InChI | InChI=1S/C5H4I2S2/c1-8-3-2-4(6)9-5(3)7/h2H,1H3 |
| InChIKey | STLOYNJPBNKSFC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.03 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|