C14H10I4S3 — CID 139623462
2-(2,6-diiodo-4-methylsulfanylphenyl)sulfanyl-1,3-diiodo-5-methylsulfanylbenzene (PubChem CID 139623462) has the molecular formula C14H10I4S3 and a molecular weight of 782.05 g/mol. Its IUPAC name is 2-(2,6-diiodo-4-methylsulfanylphenyl)sulfanyl-1,3-diiodo-5-methylsulfanylbenzene.
| Compound Name | 2-(2,6-diiodo-4-methylsulfanylphenyl)sulfanyl-1,3-diiodo-5-methylsulfanylbenzene |
|---|---|
| PubChem CID | 139623462 |
| Molecular Formula | C14H10I4S3 |
| Molecular Weight | 782.05 g/mol |
| Exact Mass | 781.61 |
| IUPAC Name | 2-(2,6-diiodo-4-methylsulfanylphenyl)sulfanyl-1,3-diiodo-5-methylsulfanylbenzene |
| SMILES | CSc1cc(I)c(Sc2c(I)cc(SC)cc2I)c(I)c1 |
| InChI | InChI=1S/C14H10I4S3/c1-19-7-3-9(15)13(10(16)4-7)21-14-11(17)5-8(20-2)6-12(14)18/h3-6H,1-2H3 |
| InChIKey | ZVQCDANIIYMFDH-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.05 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|