C8H11IN2 — CID 130548955
4,6-diethyl-2-iodopyrimidine (PubChem CID 130548955) has the molecular formula C8H11IN2 and a molecular weight of 262.09 g/mol. Its IUPAC name is 4,6-diethyl-2-iodopyrimidine.
| Compound Name | 4,6-diethyl-2-iodopyrimidine |
|---|---|
| PubChem CID | 130548955 |
| Molecular Formula | C8H11IN2 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 4,6-diethyl-2-iodopyrimidine |
| SMILES | CCc1cc(CC)nc(I)n1 |
| InChI | InChI=1S/C8H11IN2/c1-3-6-5-7(4-2)11-8(9)10-6/h5H,3-4H2,1-2H3 |
| InChIKey | TUZHIVBVVUXMBY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|