About 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine
5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 123636037) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
Analyze 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The IUPAC name of 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (CID 123636037) is 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The canonical SMILES for 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine is CCc1cc(C)n2nc(C)nc2n1.
What is the InChIKey of 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The InChIKey is GZMYTPYDYRNUSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-4-8-5-6(2)13-9(11-8)10-7(3)12-13/h5H,4H2,1-3H3.
What are the key properties of 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine has a molecular weight of 176.22 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine is sourced from PubChem (CID 123636037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).