C22H22O6 — CID 175639749
5-[2-[3-[2-(3,5-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]ethyl]benzene-1,2,3-triol (PubChem CID 175639749) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 5-[2-[3-[2-(3,5-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]ethyl]benzene-1,2,3-triol.
| Compound Name | 5-[2-[3-[2-(3,5-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]ethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 175639749 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 5-[2-[3-[2-(3,5-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]ethyl]benzene-1,2,3-triol |
| SMILES | Oc1cc(O)cc(CCc2cccc(CCc3cc(O)c(O)c(O)c3)c2O)c1 |
| InChI | InChI=1S/C22H22O6/c23-17-8-13(9-18(24)12-17)4-6-15-2-1-3-16(21(15)27)7-5-14-10-19(25)22(28)20(26)11-14/h1-3,8-12,23-28H,4-7H2 |
| InChIKey | MDJYBDKXLPWMOD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|