C30H30O8 — CID 172870603
5-[2-[5-methoxy-2-[4-methoxy-2-[2-(3,4,5-trihydroxyphenyl)ethyl]phenyl]phenyl]ethyl]benzene-1,2,3-triol (PubChem CID 172870603) has the molecular formula C30H30O8 and a molecular weight of 518.56 g/mol. Its IUPAC name is 5-[2-[5-methoxy-2-[4-methoxy-2-[2-(3,4,5-trihydroxyphenyl)ethyl]phenyl]phenyl]ethyl]benzene-1,2,3-triol.
| Compound Name | 5-[2-[5-methoxy-2-[4-methoxy-2-[2-(3,4,5-trihydroxyphenyl)ethyl]phenyl]phenyl]ethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 172870603 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 5-[2-[5-methoxy-2-[4-methoxy-2-[2-(3,4,5-trihydroxyphenyl)ethyl]phenyl]phenyl]ethyl]benzene-1,2,3-triol |
| SMILES | COc1ccc(-c2ccc(OC)cc2CCc2cc(O)c(O)c(O)c2)c(CCc2cc(O)c(O)c(O)c2)c1 |
| InChI | InChI=1S/C30H30O8/c1-37-21-7-9-23(19(15-21)5-3-17-11-25(31)29(35)26(32)12-17)24-10-8-22(38-2)16-20(24)6-4-18-13-27(33)30(36)28(34)14-18/h7-16,31-36H,3-6H2,1-2H3 |
| InChIKey | GCYNFJPJTJXMTB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|