C31H30FNO6 — CID 122368998
5-[2-[2-[2-[2-(4-fluoro-3-nitrophenyl)ethyl]-4-methoxyphenyl]-5-methoxyphenyl]ethyl]-2-methoxyphenol (PubChem CID 122368998) has the molecular formula C31H30FNO6 and a molecular weight of 531.58 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-(4-fluoro-3-nitrophenyl)ethyl]-4-methoxyphenyl]-5-methoxyphenyl]ethyl]-2-methoxyphenol.
| Compound Name | 5-[2-[2-[2-[2-(4-fluoro-3-nitrophenyl)ethyl]-4-methoxyphenyl]-5-methoxyphenyl]ethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 122368998 |
| Molecular Formula | C31H30FNO6 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 5-[2-[2-[2-[2-(4-fluoro-3-nitrophenyl)ethyl]-4-methoxyphenyl]-5-methoxyphenyl]ethyl]-2-methoxyphenol |
| SMILES | COc1ccc(-c2ccc(OC)cc2CCc2ccc(F)c([N+](=O)[O-])c2)c(CCc2ccc(OC)c(O)c2)c1 |
| InChI | InChI=1S/C31H30FNO6/c1-37-24-10-12-26(22(18-24)8-4-20-6-14-28(32)29(16-20)33(35)36)27-13-11-25(38-2)19-23(27)9-5-21-7-15-31(39-3)30(34)17-21/h6-7,10-19,34H,4-5,8-9H2,1-3H3 |
| InChIKey | XNHMIBXNEPOWJD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|