C18H19NO8 — CID 69463616
2-(4-methoxy-3-nitrophenyl)acetic acid;2-(4-methoxyphenyl)acetic acid (PubChem CID 69463616) has the molecular formula C18H19NO8 and a molecular weight of 377.35 g/mol. Its IUPAC name is 2-(4-methoxy-3-nitrophenyl)acetic acid;2-(4-methoxyphenyl)acetic acid.
| Compound Name | 2-(4-methoxy-3-nitrophenyl)acetic acid;2-(4-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 69463616 |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-(4-methoxy-3-nitrophenyl)acetic acid;2-(4-methoxyphenyl)acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1.COc1ccc(CC(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9NO5.C9H10O3/c1-15-8-3-2-6(5-9(11)12)4-7(8)10(13)14;1-12-8-4-2-7(3-5-8)6-9(10)11/h2-4H,5H2,1H3,(H,11,12);2-5H,6H2,1H3,(H,10,11) |
| InChIKey | ZTKMABAACXRIQQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|