C28H31N3O14 — CID 167559334
2-(4-methoxy-3-nitrophenyl)acetic acid;2-(4-methoxy-3-nitrophenyl)ethanol;methyl 2-(4-methoxy-3-nitrophenyl)acetate (PubChem CID 167559334) has the molecular formula C28H31N3O14 and a molecular weight of 633.56 g/mol. Its IUPAC name is 2-(4-methoxy-3-nitrophenyl)acetic acid;2-(4-methoxy-3-nitrophenyl)ethanol;methyl 2-(4-methoxy-3-nitrophenyl)acetate.
| Compound Name | 2-(4-methoxy-3-nitrophenyl)acetic acid;2-(4-methoxy-3-nitrophenyl)ethanol;methyl 2-(4-methoxy-3-nitrophenyl)acetate |
|---|---|
| PubChem CID | 167559334 |
| Molecular Formula | C28H31N3O14 |
| Molecular Weight | 633.56 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | 2-(4-methoxy-3-nitrophenyl)acetic acid;2-(4-methoxy-3-nitrophenyl)ethanol;methyl 2-(4-methoxy-3-nitrophenyl)acetate |
| SMILES | COC(=O)Cc1ccc(OC)c([N+](=O)[O-])c1.COc1ccc(CC(=O)O)cc1[N+](=O)[O-].COc1ccc(CCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11NO5.C9H9NO5.C9H11NO4/c1-15-9-4-3-7(6-10(12)16-2)5-8(9)11(13)14;1-15-8-3-2-6(5-9(11)12)4-7(8)10(13)14;1-14-9-3-2-7(4-5-11)6-8(9)10(12)13/h3-5H,6H2,1-2H3;2-4H,5H2,1H3,(H,11,12);2-3,6,11H,4-5H2,1H3 |
| InChIKey | DLCPFBZSFBVUQN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 240.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|