C16H18N2O5 — CID 163876948
1-(4-methoxyphenyl)-3-[2-(3,4,5-trihydroxyphenyl)ethyl]urea (PubChem CID 163876948) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[2-(3,4,5-trihydroxyphenyl)ethyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[2-(3,4,5-trihydroxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 163876948 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[2-(3,4,5-trihydroxyphenyl)ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCc2cc(O)c(O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H18N2O5/c1-23-12-4-2-11(3-5-12)18-16(22)17-7-6-10-8-13(19)15(21)14(20)9-10/h2-5,8-9,19-21H,6-7H2,1H3,(H2,17,18,22) |
| InChIKey | PPSDSPJQPNOZRS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|