C28H26O6 — CID 172871202
3-[3-hydroxy-5-[2-(4-hydroxyphenyl)ethyl]phenoxy]-5-[2-(3-hydroxyphenyl)ethyl]benzene-1,2-diol (PubChem CID 172871202) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-[3-hydroxy-5-[2-(4-hydroxyphenyl)ethyl]phenoxy]-5-[2-(3-hydroxyphenyl)ethyl]benzene-1,2-diol.
| Compound Name | 3-[3-hydroxy-5-[2-(4-hydroxyphenyl)ethyl]phenoxy]-5-[2-(3-hydroxyphenyl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 172871202 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-[3-hydroxy-5-[2-(4-hydroxyphenyl)ethyl]phenoxy]-5-[2-(3-hydroxyphenyl)ethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CCc2cc(O)cc(Oc3cc(CCc4cccc(O)c4)cc(O)c3O)c2)cc1 |
| InChI | InChI=1S/C28H26O6/c29-22-10-8-18(9-11-22)4-6-20-13-24(31)17-25(14-20)34-27-16-21(15-26(32)28(27)33)7-5-19-2-1-3-23(30)12-19/h1-3,8-17,29-33H,4-7H2 |
| InChIKey | LHFOGSPUJZQJLP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|