C28H26O4 — CID 172871078
3-[2-(3-hydroxyphenyl)ethyl]-5-[4-[2-(3-hydroxyphenyl)ethyl]phenoxy]phenol (PubChem CID 172871078) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-[2-(3-hydroxyphenyl)ethyl]-5-[4-[2-(3-hydroxyphenyl)ethyl]phenoxy]phenol.
| Compound Name | 3-[2-(3-hydroxyphenyl)ethyl]-5-[4-[2-(3-hydroxyphenyl)ethyl]phenoxy]phenol |
|---|---|
| PubChem CID | 172871078 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-[2-(3-hydroxyphenyl)ethyl]-5-[4-[2-(3-hydroxyphenyl)ethyl]phenoxy]phenol |
| SMILES | Oc1cccc(CCc2ccc(Oc3cc(O)cc(CCc4cccc(O)c4)c3)cc2)c1 |
| InChI | InChI=1S/C28H26O4/c29-24-5-1-3-21(15-24)8-7-20-11-13-27(14-12-20)32-28-18-23(17-26(31)19-28)10-9-22-4-2-6-25(30)16-22/h1-6,11-19,29-31H,7-10H2 |
| InChIKey | PNSMHZCNLQLURO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |