C14H22O6 — CID 3020610
3,4-bis(1,3-dihydroxybutyl)benzene-1,2-diol (PubChem CID 3020610) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 3,4-bis(1,3-dihydroxybutyl)benzene-1,2-diol.
| Compound Name | 3,4-bis(1,3-dihydroxybutyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 3020610 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3,4-bis(1,3-dihydroxybutyl)benzene-1,2-diol |
| SMILES | CC(O)CC(O)c1ccc(O)c(O)c1C(O)CC(C)O |
| InChI | InChI=1S/C14H22O6/c1-7(15)5-11(18)9-3-4-10(17)14(20)13(9)12(19)6-8(2)16/h3-4,7-8,11-12,15-20H,5-6H2,1-2H3 |
| InChIKey | LLYJFEWETFSPJK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|