C12H15NS — CID 130378060
4-ethyl-7-propan-2-yl-1,3-benzothiazole (PubChem CID 130378060) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 4-ethyl-7-propan-2-yl-1,3-benzothiazole.
| Compound Name | 4-ethyl-7-propan-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 130378060 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-ethyl-7-propan-2-yl-1,3-benzothiazole |
| SMILES | CCc1ccc(C(C)C)c2scnc12 |
| InChI | InChI=1S/C12H15NS/c1-4-9-5-6-10(8(2)3)12-11(9)13-7-14-12/h5-8H,4H2,1-3H3 |
| InChIKey | DYHIQYJEMYOKDS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |