C9H10N2S — CID 166990343
4,6,7-trimethyl-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 166990343) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 4,6,7-trimethyl-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 4,6,7-trimethyl-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 166990343 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4,6,7-trimethyl-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | Cc1nc(C)c2ncsc2c1C |
| InChI | InChI=1S/C9H10N2S/c1-5-6(2)11-7(3)8-9(5)12-4-10-8/h4H,1-3H3 |
| InChIKey | OBLSHIJYMQQKEN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |