C10H14N2S — CID 144514698
6,7-dimethyl-[1,3]thiazolo[5,4-b]pyridine;ethane (PubChem CID 144514698) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 6,7-dimethyl-[1,3]thiazolo[5,4-b]pyridine;ethane.
| Compound Name | 6,7-dimethyl-[1,3]thiazolo[5,4-b]pyridine;ethane |
|---|---|
| PubChem CID | 144514698 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 6,7-dimethyl-[1,3]thiazolo[5,4-b]pyridine;ethane |
| SMILES | CC.Cc1cnc2scnc2c1C |
| InChI | InChI=1S/C8H8N2S.C2H6/c1-5-3-9-8-7(6(5)2)10-4-11-8;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | QVGOQYWLQCGNHE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |