C8H8N2OS — CID 151212590
5-methoxy-7-methyl-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 151212590) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 5-methoxy-7-methyl-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 5-methoxy-7-methyl-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 151212590 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 5-methoxy-7-methyl-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | COc1cc(C)c2ncsc2n1 |
| InChI | InChI=1S/C8H8N2OS/c1-5-3-6(11-2)10-8-7(5)9-4-12-8/h3-4H,1-2H3 |
| InChIKey | NKOYECQUCJZPAF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |