C7H5ClN2S — CID 76850479
4-chloro-7-methyl-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 76850479) has the molecular formula C7H5ClN2S and a molecular weight of 184.65 g/mol. Its IUPAC name is 4-chloro-7-methyl-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 4-chloro-7-methyl-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 76850479 |
| Molecular Formula | C7H5ClN2S |
| Molecular Weight | 184.65 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 4-chloro-7-methyl-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | Cc1cnc(Cl)c2ncsc12 |
| InChI | InChI=1S/C7H5ClN2S/c1-4-2-9-7(8)5-6(4)11-3-10-5/h2-3H,1H3 |
| InChIKey | IUOZHXGQEJBOKP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|