C15H15NS3 — CID 144537701
9,14-dimethyl-3,10,13-trithia-5-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,8,11,14-hexaene;ethane (PubChem CID 144537701) has the molecular formula C15H15NS3 and a molecular weight of 305.49 g/mol. Its IUPAC name is 9,14-dimethyl-3,10,13-trithia-5-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,8,11,14-hexaene;ethane.
| Compound Name | 9,14-dimethyl-3,10,13-trithia-5-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,8,11,14-hexaene;ethane |
|---|---|
| PubChem CID | 144537701 |
| Molecular Formula | C15H15NS3 |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 9,14-dimethyl-3,10,13-trithia-5-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,8,11,14-hexaene;ethane |
| SMILES | CC.Cc1cc2c3ncsc3c3cc(C)sc3c2s1 |
| InChI | InChI=1S/C13H9NS3.C2H6/c1-6-3-8-10-11(15-5-14-10)9-4-7(2)17-13(9)12(8)16-6;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | LNVFNVDGTSBBRT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |