C8H8N2S — CID 58570410
4,6-dimethyl-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 58570410) has the molecular formula C8H8N2S and a molecular weight of 164.23 g/mol. Its IUPAC name is 4,6-dimethyl-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 4,6-dimethyl-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 58570410 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 4,6-dimethyl-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | Cc1cc2scnc2c(C)n1 |
| InChI | InChI=1S/C8H8N2S/c1-5-3-7-8(6(2)10-5)9-4-11-7/h3-4H,1-2H3 |
| InChIKey | HCZCUSKLXAVWBL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |