About 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol
7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol (PubChem CID 126501615) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol.
Molecular Properties
| Compound Name | 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol |
| PubChem CID | 126501615 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol |
| SMILES | OCCc1ccc(O)c2ncsc12 |
| InChI | InChI=1S/C9H9NO2S/c11-4-3-6-1-2-7(12)8-9(6)13-5-10-8/h1-2,5,11-12H,3-4H2 |
| InChIKey | ODIJXYWKSUIMPG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol?
The IUPAC name of 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol (CID 126501615) is 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol.
What is the SMILES notation for 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol?
The canonical SMILES for 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol is OCCc1ccc(O)c2ncsc12.
What is the InChIKey of 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol?
The InChIKey is ODIJXYWKSUIMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c11-4-3-6-1-2-7(12)8-9(6)13-5-10-8/h1-2,5,11-12H,3-4H2.
What are the key properties of 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol?
7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol has a molecular weight of 195.24 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol is sourced from PubChem (CID 126501615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).