C9H9NO2S — CID 126501615
7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol (PubChem CID 126501615) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol.
| Compound Name | 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 126501615 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 7-(2-hydroxyethyl)-1,3-benzothiazol-4-ol |
| SMILES | OCCc1ccc(O)c2ncsc12 |
| InChI | InChI=1S/C9H9NO2S/c11-4-3-6-1-2-7(12)8-9(6)13-5-10-8/h1-2,5,11-12H,3-4H2 |
| InChIKey | ODIJXYWKSUIMPG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |