C12H13NO2S — CID 107713207
2-[2-(1,3-thiazol-5-ylmethoxy)phenyl]ethanol (PubChem CID 107713207) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[2-(1,3-thiazol-5-ylmethoxy)phenyl]ethanol.
| Compound Name | 2-[2-(1,3-thiazol-5-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 107713207 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-[2-(1,3-thiazol-5-ylmethoxy)phenyl]ethanol |
| SMILES | OCCc1ccccc1OCc1cncs1 |
| InChI | InChI=1S/C12H13NO2S/c14-6-5-10-3-1-2-4-12(10)15-8-11-7-13-9-16-11/h1-4,7,9,14H,5-6,8H2 |
| InChIKey | WNICRQFYXXHPMT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |