C12H12BrNO2S — CID 112641131
5-[[2-(bromomethyl)-6-methoxyphenoxy]methyl]-1,3-thiazole (PubChem CID 112641131) has the molecular formula C12H12BrNO2S and a molecular weight of 314.20 g/mol. Its IUPAC name is 5-[[2-(bromomethyl)-6-methoxyphenoxy]methyl]-1,3-thiazole.
| Compound Name | 5-[[2-(bromomethyl)-6-methoxyphenoxy]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112641131 |
| Molecular Formula | C12H12BrNO2S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 5-[[2-(bromomethyl)-6-methoxyphenoxy]methyl]-1,3-thiazole |
| SMILES | COc1cccc(CBr)c1OCc1cncs1 |
| InChI | InChI=1S/C12H12BrNO2S/c1-15-11-4-2-3-9(5-13)12(11)16-7-10-6-14-8-17-10/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | FJSAKLYXQDOZRT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|