C15H13BrF2O2 — CID 43659017
1-(bromomethyl)-2-[(2,3-difluorophenyl)methoxy]-3-methoxybenzene (PubChem CID 43659017) has the molecular formula C15H13BrF2O2 and a molecular weight of 343.17 g/mol. Its IUPAC name is 1-(bromomethyl)-2-[(2,3-difluorophenyl)methoxy]-3-methoxybenzene.
| Compound Name | 1-(bromomethyl)-2-[(2,3-difluorophenyl)methoxy]-3-methoxybenzene |
|---|---|
| PubChem CID | 43659017 |
| Molecular Formula | C15H13BrF2O2 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 1-(bromomethyl)-2-[(2,3-difluorophenyl)methoxy]-3-methoxybenzene |
| SMILES | COc1cccc(CBr)c1OCc1cccc(F)c1F |
| InChI | InChI=1S/C15H13BrF2O2/c1-19-13-7-3-4-10(8-16)15(13)20-9-11-5-2-6-12(17)14(11)18/h2-7H,8-9H2,1H3 |
| InChIKey | LWOUKSYTKDHBLU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|