C12H12ClNOS — CID 112641170
5-[[2-(chloromethyl)-6-methylphenoxy]methyl]-1,3-thiazole (PubChem CID 112641170) has the molecular formula C12H12ClNOS and a molecular weight of 253.75 g/mol. Its IUPAC name is 5-[[2-(chloromethyl)-6-methylphenoxy]methyl]-1,3-thiazole.
| Compound Name | 5-[[2-(chloromethyl)-6-methylphenoxy]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112641170 |
| Molecular Formula | C12H12ClNOS |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 5-[[2-(chloromethyl)-6-methylphenoxy]methyl]-1,3-thiazole |
| SMILES | Cc1cccc(CCl)c1OCc1cncs1 |
| InChI | InChI=1S/C12H12ClNOS/c1-9-3-2-4-10(5-13)12(9)15-7-11-6-14-8-16-11/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | LIWSMSOQXOECJT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|