C11H8BrCl2NOS — CID 112641139
5-[[2-(bromomethyl)-4,6-dichlorophenoxy]methyl]-1,3-thiazole (PubChem CID 112641139) has the molecular formula C11H8BrCl2NOS and a molecular weight of 353.07 g/mol. Its IUPAC name is 5-[[2-(bromomethyl)-4,6-dichlorophenoxy]methyl]-1,3-thiazole.
| Compound Name | 5-[[2-(bromomethyl)-4,6-dichlorophenoxy]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112641139 |
| Molecular Formula | C11H8BrCl2NOS |
| Molecular Weight | 353.07 g/mol |
| Exact Mass | 350.89 |
| IUPAC Name | 5-[[2-(bromomethyl)-4,6-dichlorophenoxy]methyl]-1,3-thiazole |
| SMILES | Clc1cc(Cl)c(OCc2cncs2)c(CBr)c1 |
| InChI | InChI=1S/C11H8BrCl2NOS/c12-3-7-1-8(13)2-10(14)11(7)16-5-9-4-15-6-17-9/h1-2,4,6H,3,5H2 |
| InChIKey | XRYVIUVJJLNACF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.07 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|