C10H8Cl2N2OS — CID 112640173
3,5-dichloro-4-(1,3-thiazol-5-ylmethoxy)aniline (PubChem CID 112640173) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is 3,5-dichloro-4-(1,3-thiazol-5-ylmethoxy)aniline.
| Compound Name | 3,5-dichloro-4-(1,3-thiazol-5-ylmethoxy)aniline |
|---|---|
| PubChem CID | 112640173 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 3,5-dichloro-4-(1,3-thiazol-5-ylmethoxy)aniline |
| SMILES | Nc1cc(Cl)c(OCc2cncs2)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-8-1-6(13)2-9(12)10(8)15-4-7-3-14-5-16-7/h1-3,5H,4,13H2 |
| InChIKey | TVXJNQBZPHEUFQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|