C11H12N2OS — CID 112640171
4-(1,3-thiazol-5-ylmethoxymethyl)aniline (PubChem CID 112640171) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 4-(1,3-thiazol-5-ylmethoxymethyl)aniline.
| Compound Name | 4-(1,3-thiazol-5-ylmethoxymethyl)aniline |
|---|---|
| PubChem CID | 112640171 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 4-(1,3-thiazol-5-ylmethoxymethyl)aniline |
| SMILES | Nc1ccc(COCc2cncs2)cc1 |
| InChI | InChI=1S/C11H12N2OS/c12-10-3-1-9(2-4-10)6-14-7-11-5-13-8-15-11/h1-5,8H,6-7,12H2 |
| InChIKey | VMRMNDKZWQKIOI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|