C12H14BrN3S — CID 105195489
[1-(4-bromophenyl)-3-(1,3-thiazol-5-yl)propan-2-yl]hydrazine (PubChem CID 105195489) has the molecular formula C12H14BrN3S and a molecular weight of 312.24 g/mol. Its IUPAC name is [1-(4-bromophenyl)-3-(1,3-thiazol-5-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(4-bromophenyl)-3-(1,3-thiazol-5-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105195489 |
| Molecular Formula | C12H14BrN3S |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | [1-(4-bromophenyl)-3-(1,3-thiazol-5-yl)propan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccc(Br)cc1)Cc1cncs1 |
| InChI | InChI=1S/C12H14BrN3S/c13-10-3-1-9(2-4-10)5-11(16-14)6-12-7-15-8-17-12/h1-4,7-8,11,16H,5-6,14H2 |
| InChIKey | FUYAICQFFGWYQM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|