C9H17N3OS — CID 105331931
[1-propan-2-yloxy-3-(1,3-thiazol-5-yl)propan-2-yl]hydrazine (PubChem CID 105331931) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is [1-propan-2-yloxy-3-(1,3-thiazol-5-yl)propan-2-yl]hydrazine.
| Compound Name | [1-propan-2-yloxy-3-(1,3-thiazol-5-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105331931 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | [1-propan-2-yloxy-3-(1,3-thiazol-5-yl)propan-2-yl]hydrazine |
| SMILES | CC(C)OCC(Cc1cncs1)NN |
| InChI | InChI=1S/C9H17N3OS/c1-7(2)13-5-8(12-10)3-9-4-11-6-14-9/h4,6-8,12H,3,5,10H2,1-2H3 |
| InChIKey | PBOSXTVQQOLDJD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|